C23H39N3O4Si — CID 86655569
tert-butyl N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(1R)-4-(N'-hydroxycarbamimidoyl)-2,3-dihydro-1H-inden-1-yl]carbamate (PubChem CID 86655569) has the molecular formula C23H39N3O4Si and a molecular weight of 449.67 g/mol. Its IUPAC name is tert-butyl N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(1R)-4-(N'-hydroxycarbamimidoyl)-2,3-dihydro-1H-inden-1-yl]carbamate.
| Compound Name | tert-butyl N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(1R)-4-(N'-hydroxycarbamimidoyl)-2,3-dihydro-1H-inden-1-yl]carbamate |
|---|---|
| PubChem CID | 86655569 |
| Molecular Formula | C23H39N3O4Si |
| Molecular Weight | 449.67 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | tert-butyl N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-N-[(1R)-4-(N'-hydroxycarbamimidoyl)-2,3-dihydro-1H-inden-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCO[Si](C)(C)C(C)(C)C)[C@@H]1CCc2c(C(N)=NO)cccc21 |
| InChI | InChI=1S/C23H39N3O4Si/c1-22(2,3)30-21(27)26(14-15-29-31(7,8)23(4,5)6)19-13-12-16-17(19)10-9-11-18(16)20(24)25-28/h9-11,19,28H,12-15H2,1-8H3,(H2,24,25)/t19-/m1/s1 |
| InChIKey | SBILRNWFWIDOLV-LJQANCHMSA-N |
| XLogP | 5.03 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|