About 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-quinolin-8-ylpyridine-3-carbaldehyde
2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-quinolin-8-ylpyridine-3-carbaldehyde (PubChem CID 86655627) has the molecular formula C21H21N3O2
and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-quinolin-8-ylpyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-quinolin-8-ylpyridine-3-carbaldehyde |
| PubChem CID | 86655627 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-quinolin-8-ylpyridine-3-carbaldehyde |
| SMILES | C[C@@H]1CN(c2ncc(-c3cccc4cccnc34)cc2C=O)C[C@H](C)O1 |
| InChI | InChI=1S/C21H21N3O2/c1-14-11-24(12-15(2)26-14)21-18(13-25)9-17(10-23-21)19-7-3-5-16-6-4-8-22-20(16)19/h3-10,13-15H,11-12H2,1-2H3/t14-,15+ |
| InChIKey | JTAXKCMBVYNRGO-GASCZTMLSA-N |
| XLogP | 3.72 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-quinolin-8-ylpyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-quinolin-8-ylpyridine-3-carbaldehyde?
The IUPAC name of 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-quinolin-8-ylpyridine-3-carbaldehyde (CID 86655627) is 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-quinolin-8-ylpyridine-3-carbaldehyde.
What is the SMILES notation for 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-quinolin-8-ylpyridine-3-carbaldehyde?
The canonical SMILES for 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-quinolin-8-ylpyridine-3-carbaldehyde is C[C@@H]1CN(c2ncc(-c3cccc4cccnc34)cc2C=O)C[C@H](C)O1.
What is the InChIKey of 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-quinolin-8-ylpyridine-3-carbaldehyde?
The InChIKey is JTAXKCMBVYNRGO-GASCZTMLSA-N. The full InChI is InChI=1S/C21H21N3O2/c1-14-11-24(12-15(2)26-14)21-18(13-25)9-17(10-23-21)19-7-3-5-16-6-4-8-22-20(16)19/h3-10,13-15H,11-12H2,1-2H3/t14-,15+.
What are the key properties of 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-quinolin-8-ylpyridine-3-carbaldehyde?
2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-quinolin-8-ylpyridine-3-carbaldehyde has a molecular weight of 347.42 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-quinolin-8-ylpyridine-3-carbaldehyde is sourced from PubChem (CID 86655627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).