About N-cyclopropyl-3,5-bis(trifluoromethyl)aniline
N-cyclopropyl-3,5-bis(trifluoromethyl)aniline (PubChem CID 86655697) has the molecular formula C11H9F6N
and a molecular weight of 269.19 g/mol. Its IUPAC name is N-cyclopropyl-3,5-bis(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | N-cyclopropyl-3,5-bis(trifluoromethyl)aniline |
| PubChem CID | 86655697 |
| Molecular Formula | C11H9F6N |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | N-cyclopropyl-3,5-bis(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(NC2CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F6N/c12-10(13,14)6-3-7(11(15,16)17)5-9(4-6)18-8-1-2-8/h3-5,8,18H,1-2H2 |
| InChIKey | CHDYOHXGXQIHNB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclopropyl-3,5-bis(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-3,5-bis(trifluoromethyl)aniline?
The IUPAC name of N-cyclopropyl-3,5-bis(trifluoromethyl)aniline (CID 86655697) is N-cyclopropyl-3,5-bis(trifluoromethyl)aniline.
What is the SMILES notation for N-cyclopropyl-3,5-bis(trifluoromethyl)aniline?
The canonical SMILES for N-cyclopropyl-3,5-bis(trifluoromethyl)aniline is FC(F)(F)c1cc(NC2CC2)cc(C(F)(F)F)c1.
What is the InChIKey of N-cyclopropyl-3,5-bis(trifluoromethyl)aniline?
The InChIKey is CHDYOHXGXQIHNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F6N/c12-10(13,14)6-3-7(11(15,16)17)5-9(4-6)18-8-1-2-8/h3-5,8,18H,1-2H2.
What are the key properties of N-cyclopropyl-3,5-bis(trifluoromethyl)aniline?
N-cyclopropyl-3,5-bis(trifluoromethyl)aniline has a molecular weight of 269.19 g/mol, XLogP of 4.30, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-3,5-bis(trifluoromethyl)aniline is sourced from PubChem (CID 86655697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).