C28H27F7N4O5 — CID 86655728
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3S,4R)-1-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)acetyl]-4-(4-fluorophenyl)pyrrolidin-3-yl]-1,3-dimethylurea (PubChem CID 86655728) has the molecular formula C28H27F7N4O5 and a molecular weight of 632.53 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3S,4R)-1-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)acetyl]-4-(4-fluorophenyl)pyrrolidin-3-yl]-1,3-dimethylurea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3S,4R)-1-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)acetyl]-4-(4-fluorophenyl)pyrrolidin-3-yl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 86655728 |
| Molecular Formula | C28H27F7N4O5 |
| Molecular Weight | 632.53 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3S,4R)-1-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)acetyl]-4-(4-fluorophenyl)pyrrolidin-3-yl]-1,3-dimethylurea |
| SMILES | CN(C(=O)N(C)[C@@H]1CN(C(=O)CN2C(=O)OC(C)(C)C2=O)C[C@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H27F7N4O5/c1-26(2)23(41)39(25(43)44-26)14-22(40)38-12-20(15-5-7-18(29)8-6-15)21(13-38)37(4)24(42)36(3)19-10-16(27(30,31)32)9-17(11-19)28(33,34)35/h5-11,20-21H,12-14H2,1-4H3/t20-,21+/m0/s1 |
| InChIKey | RWOKIALXMMVTRY-LEWJYISDSA-N |
| XLogP | 5.10 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |