C13H13F6N3O7 — CID 86656286
5-nitro-2-[(3R)-pyrrolidin-3-yl]oxypyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 86656286) has the molecular formula C13H13F6N3O7 and a molecular weight of 437.25 g/mol. Its IUPAC name is 5-nitro-2-[(3R)-pyrrolidin-3-yl]oxypyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 5-nitro-2-[(3R)-pyrrolidin-3-yl]oxypyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 86656286 |
| Molecular Formula | C13H13F6N3O7 |
| Molecular Weight | 437.25 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 5-nitro-2-[(3R)-pyrrolidin-3-yl]oxypyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=[N+]([O-])c1ccc(O[C@@H]2CCNC2)nc1 |
| InChI | InChI=1S/C9H11N3O3.2C2HF3O2/c13-12(14)7-1-2-9(11-5-7)15-8-3-4-10-6-8;2*3-2(4,5)1(6)7/h1-2,5,8,10H,3-4,6H2;2*(H,6,7)/t8-;;/m1../s1 |
| InChIKey | PFEKREDVKITJQV-YCBDHFTFSA-N |
| XLogP | 2.00 |
| TPSA | 151.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|