C11H19F2NO3 — CID 86656431
butyl N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]carbamate (PubChem CID 86656431) has the molecular formula C11H19F2NO3 and a molecular weight of 251.27 g/mol. Its IUPAC name is butyl N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]carbamate.
| Compound Name | butyl N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 86656431 |
| Molecular Formula | C11H19F2NO3 |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | butyl N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]carbamate |
| SMILES | CCCCOC(=O)N[C@@H]1CCCC(F)(F)[C@H]1O |
| InChI | InChI=1S/C11H19F2NO3/c1-2-3-7-17-10(16)14-8-5-4-6-11(12,13)9(8)15/h8-9,15H,2-7H2,1H3,(H,14,16)/t8-,9+/m1/s1 |
| InChIKey | GAGGLWUXEHZSTD-BDAKNGLRSA-N |
| XLogP | 2.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|