About bis(2-methylpropyl)alumanylium;dichloromethane;hydride
bis(2-methylpropyl)alumanylium;dichloromethane;hydride (PubChem CID 86656508) has the molecular formula C9H21AlCl2
and a molecular weight of 227.15 g/mol. Its IUPAC name is bis(2-methylpropyl)alumanylium;dichloromethane;hydride.
Molecular Properties
| Compound Name | bis(2-methylpropyl)alumanylium;dichloromethane;hydride |
| PubChem CID | 86656508 |
| Molecular Formula | C9H21AlCl2 |
| Molecular Weight | 227.15 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | bis(2-methylpropyl)alumanylium;dichloromethane;hydride |
| SMILES | CC(C)C[Al+]CC(C)C.ClCCl.[H-] |
| InChI | InChI=1S/2C4H9.CH2Cl2.Al.H/c2*1-4(2)3;2-1-3;;/h2*4H,1H2,2-3H3;1H2;;/q;;;+1;-1 |
| InChIKey | KEAMKGGTGACVAJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.15 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylpropyl)alumanylium;dichloromethane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpropyl)alumanylium;dichloromethane;hydride?
The IUPAC name of bis(2-methylpropyl)alumanylium;dichloromethane;hydride (CID 86656508) is bis(2-methylpropyl)alumanylium;dichloromethane;hydride.
What is the SMILES notation for bis(2-methylpropyl)alumanylium;dichloromethane;hydride?
The canonical SMILES for bis(2-methylpropyl)alumanylium;dichloromethane;hydride is CC(C)C[Al+]CC(C)C.ClCCl.[H-].
What is the InChIKey of bis(2-methylpropyl)alumanylium;dichloromethane;hydride?
The InChIKey is KEAMKGGTGACVAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H9.CH2Cl2.Al.H/c2*1-4(2)3;2-1-3;;/h2*4H,1H2,2-3H3;1H2;;/q;;;+1;-1.
What are the key properties of bis(2-methylpropyl)alumanylium;dichloromethane;hydride?
bis(2-methylpropyl)alumanylium;dichloromethane;hydride has a molecular weight of 227.15 g/mol, XLogP of 4.37, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpropyl)alumanylium;dichloromethane;hydride is sourced from PubChem (CID 86656508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).