About [(3R,4R)-1-benzyl-4-(trifluoromethylsulfonyloxy)pyrrolidin-3-yl] trifluoromethanesulfonate
[(3R,4R)-1-benzyl-4-(trifluoromethylsulfonyloxy)pyrrolidin-3-yl] trifluoromethanesulfonate (PubChem CID 86656566) has the molecular formula C13H13F6NO6S2
and a molecular weight of 457.37 g/mol. Its IUPAC name is [(3R,4R)-1-benzyl-4-(trifluoromethylsulfonyloxy)pyrrolidin-3-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(3R,4R)-1-benzyl-4-(trifluoromethylsulfonyloxy)pyrrolidin-3-yl] trifluoromethanesulfonate |
| PubChem CID | 86656566 |
| Molecular Formula | C13H13F6NO6S2 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 457.01 |
| IUPAC Name | [(3R,4R)-1-benzyl-4-(trifluoromethylsulfonyloxy)pyrrolidin-3-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(O[C@@H]1CN(Cc2ccccc2)C[C@H]1OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H13F6NO6S2/c14-12(15,16)27(21,22)25-10-7-20(6-9-4-2-1-3-5-9)8-11(10)26-28(23,24)13(17,18)19/h1-5,10-11H,6-8H2/t10-,11-/m1/s1 |
| InChIKey | BLAIDPFLSIFIMA-GHMZBOCLSA-N |
| XLogP | 1.97 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4R)-1-benzyl-4-(trifluoromethylsulfonyloxy)pyrrolidin-3-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-1-benzyl-4-(trifluoromethylsulfonyloxy)pyrrolidin-3-yl] trifluoromethanesulfonate?
The IUPAC name of [(3R,4R)-1-benzyl-4-(trifluoromethylsulfonyloxy)pyrrolidin-3-yl] trifluoromethanesulfonate (CID 86656566) is [(3R,4R)-1-benzyl-4-(trifluoromethylsulfonyloxy)pyrrolidin-3-yl] trifluoromethanesulfonate.
What is the SMILES notation for [(3R,4R)-1-benzyl-4-(trifluoromethylsulfonyloxy)pyrrolidin-3-yl] trifluoromethanesulfonate?
The canonical SMILES for [(3R,4R)-1-benzyl-4-(trifluoromethylsulfonyloxy)pyrrolidin-3-yl] trifluoromethanesulfonate is O=S(=O)(O[C@@H]1CN(Cc2ccccc2)C[C@H]1OS(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of [(3R,4R)-1-benzyl-4-(trifluoromethylsulfonyloxy)pyrrolidin-3-yl] trifluoromethanesulfonate?
The InChIKey is BLAIDPFLSIFIMA-GHMZBOCLSA-N. The full InChI is InChI=1S/C13H13F6NO6S2/c14-12(15,16)27(21,22)25-10-7-20(6-9-4-2-1-3-5-9)8-11(10)26-28(23,24)13(17,18)19/h1-5,10-11H,6-8H2/t10-,11-/m1/s1.
What are the key properties of [(3R,4R)-1-benzyl-4-(trifluoromethylsulfonyloxy)pyrrolidin-3-yl] trifluoromethanesulfonate?
[(3R,4R)-1-benzyl-4-(trifluoromethylsulfonyloxy)pyrrolidin-3-yl] trifluoromethanesulfonate has a molecular weight of 457.37 g/mol, XLogP of 1.97, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-1-benzyl-4-(trifluoromethylsulfonyloxy)pyrrolidin-3-yl] trifluoromethanesulfonate is sourced from PubChem (CID 86656566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).