C13H8ClNO2 — CID 86656744
3-chloro-5H-[1]benzoxepino[3,4-b]pyridin-11-one (PubChem CID 86656744) has the molecular formula C13H8ClNO2 and a molecular weight of 245.67 g/mol. Its IUPAC name is 3-chloro-5H-[1]benzoxepino[3,4-b]pyridin-11-one.
| Compound Name | 3-chloro-5H-[1]benzoxepino[3,4-b]pyridin-11-one |
|---|---|
| PubChem CID | 86656744 |
| Molecular Formula | C13H8ClNO2 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.02 |
| IUPAC Name | 3-chloro-5H-[1]benzoxepino[3,4-b]pyridin-11-one |
| SMILES | O=C1c2ccccc2OCc2nc(Cl)ccc21 |
| InChI | InChI=1S/C13H8ClNO2/c14-12-6-5-8-10(15-12)7-17-11-4-2-1-3-9(11)13(8)16/h1-6H,7H2 |
| InChIKey | KAOGIKCULSBCKT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|