About 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid
2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid (PubChem CID 86656941) has the molecular formula C18H15ClN4O3S
and a molecular weight of 402.86 g/mol. Its IUPAC name is 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid |
| PubChem CID | 86656941 |
| Molecular Formula | C18H15ClN4O3S |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid |
| SMILES | COCCn1c(Nc2nc3ccc(Cl)cc3s2)nc2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C18H15ClN4O3S/c1-26-7-6-23-14-5-2-10(16(24)25)8-13(14)20-17(23)22-18-21-12-4-3-11(19)9-15(12)27-18/h2-5,8-9H,6-7H2,1H3,(H,24,25)(H,20,21,22) |
| InChIKey | YSAFLTFWLWEJKB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid?
The IUPAC name of 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid (CID 86656941) is 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid.
What is the SMILES notation for 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid?
The canonical SMILES for 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid is COCCn1c(Nc2nc3ccc(Cl)cc3s2)nc2cc(C(=O)O)ccc21.
What is the InChIKey of 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid?
The InChIKey is YSAFLTFWLWEJKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClN4O3S/c1-26-7-6-23-14-5-2-10(16(24)25)8-13(14)20-17(23)22-18-21-12-4-3-11(19)9-15(12)27-18/h2-5,8-9H,6-7H2,1H3,(H,24,25)(H,20,21,22).
What are the key properties of 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid?
2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid has a molecular weight of 402.86 g/mol, XLogP of 4.39, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-methoxyethyl)benzimidazole-5-carboxylic acid is sourced from PubChem (CID 86656941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).