C22H27FO4S — CID 86657121
2-[(1S,2S)-6-fluoro-2-hydroxy-1-propan-2-yl-3,4-dihydro-1H-naphthalen-2-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 86657121) has the molecular formula C22H27FO4S and a molecular weight of 406.52 g/mol. Its IUPAC name is 2-[(1S,2S)-6-fluoro-2-hydroxy-1-propan-2-yl-3,4-dihydro-1H-naphthalen-2-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(1S,2S)-6-fluoro-2-hydroxy-1-propan-2-yl-3,4-dihydro-1H-naphthalen-2-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86657121 |
| Molecular Formula | C22H27FO4S |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-[(1S,2S)-6-fluoro-2-hydroxy-1-propan-2-yl-3,4-dihydro-1H-naphthalen-2-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@@]2(O)CCc3cc(F)ccc3[C@@H]2C(C)C)cc1 |
| InChI | InChI=1S/C22H27FO4S/c1-15(2)21-20-9-6-18(23)14-17(20)10-11-22(21,24)12-13-27-28(25,26)19-7-4-16(3)5-8-19/h4-9,14-15,21,24H,10-13H2,1-3H3/t21-,22-/m0/s1 |
| InChIKey | ROTGKNXENPLVHL-VXKWHMMOSA-N |
| XLogP | 4.35 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|