C27H22Cl2F4N4O4 — CID 86657191
1-[4-[(2R,5R)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperidine (PubChem CID 86657191) has the molecular formula C27H22Cl2F4N4O4 and a molecular weight of 613.40 g/mol. Its IUPAC name is 1-[4-[(2R,5R)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperidine.
| Compound Name | 1-[4-[(2R,5R)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperidine |
|---|---|
| PubChem CID | 86657191 |
| Molecular Formula | C27H22Cl2F4N4O4 |
| Molecular Weight | 613.40 g/mol |
| Exact Mass | 612.10 |
| IUPAC Name | 1-[4-[(2R,5R)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]piperidine |
| SMILES | O=[N+]([O-])c1cc([C@H]2CC[C@H](c3cc([N+](=O)[O-])c(Cl)cc3F)N2c2cc(F)c(N3CCCCC3)c(F)c2)c(F)cc1Cl |
| InChI | InChI=1S/C27H22Cl2F4N4O4/c28-17-12-19(30)15(10-25(17)36(38)39)23-4-5-24(16-11-26(37(40)41)18(29)13-20(16)31)35(23)14-8-21(32)27(22(33)9-14)34-6-2-1-3-7-34/h8-13,23-24H,1-7H2/t23-,24-/m1/s1 |
| InChIKey | SXEUFKYPHFBESV-DNQXCXABSA-N |
| XLogP | 8.44 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.40 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|