About 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;triphenylsulfanium
2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;triphenylsulfanium (PubChem CID 86657208) has the molecular formula C27H26F2O4S
and a molecular weight of 484.56 g/mol. Its IUPAC name is 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;triphenylsulfanium.
Molecular Properties
| Compound Name | 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;triphenylsulfanium |
| PubChem CID | 86657208 |
| Molecular Formula | C27H26F2O4S |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;triphenylsulfanium |
| SMILES | C=C(C)C(=O)OC(CC)C(F)(F)C(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C9H12F2O4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-6(9(10,11)8(13)14)15-7(12)5(2)3/h1-15H;6H,2,4H2,1,3H3,(H,13,14)/q+1;/p-1 |
| InChIKey | GWBSIYFBUAYWKS-UHFFFAOYSA-M |
| XLogP | 5.05 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;triphenylsulfanium?
The IUPAC name of 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;triphenylsulfanium (CID 86657208) is 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;triphenylsulfanium.
What is the SMILES notation for 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;triphenylsulfanium?
The canonical SMILES for 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;triphenylsulfanium is C=C(C)C(=O)OC(CC)C(F)(F)C(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;triphenylsulfanium?
The InChIKey is GWBSIYFBUAYWKS-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C9H12F2O4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-6(9(10,11)8(13)14)15-7(12)5(2)3/h1-15H;6H,2,4H2,1,3H3,(H,13,14)/q+1;/p-1.
What are the key properties of 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;triphenylsulfanium?
2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;triphenylsulfanium has a molecular weight of 484.56 g/mol, XLogP of 5.05, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-3-(2-methylprop-2-enoyloxy)pentanoate;triphenylsulfanium is sourced from PubChem (CID 86657208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).