About N-(4-ethenyl-2,3-dihydroinden-1-ylidene)hydroxylamine
N-(4-ethenyl-2,3-dihydroinden-1-ylidene)hydroxylamine (PubChem CID 86657345) has the molecular formula C11H11NO
and a molecular weight of 173.22 g/mol. Its IUPAC name is N-(4-ethenyl-2,3-dihydroinden-1-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(4-ethenyl-2,3-dihydroinden-1-ylidene)hydroxylamine |
| PubChem CID | 86657345 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | N-(4-ethenyl-2,3-dihydroinden-1-ylidene)hydroxylamine |
| SMILES | C=Cc1cccc2c1CCC2=NO |
| InChI | InChI=1S/C11H11NO/c1-2-8-4-3-5-10-9(8)6-7-11(10)12-13/h2-5,13H,1,6-7H2 |
| InChIKey | AEZADCLKGKUAPQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-ethenyl-2,3-dihydroinden-1-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethenyl-2,3-dihydroinden-1-ylidene)hydroxylamine?
The IUPAC name of N-(4-ethenyl-2,3-dihydroinden-1-ylidene)hydroxylamine (CID 86657345) is N-(4-ethenyl-2,3-dihydroinden-1-ylidene)hydroxylamine.
What is the SMILES notation for N-(4-ethenyl-2,3-dihydroinden-1-ylidene)hydroxylamine?
The canonical SMILES for N-(4-ethenyl-2,3-dihydroinden-1-ylidene)hydroxylamine is C=Cc1cccc2c1CCC2=NO.
What is the InChIKey of N-(4-ethenyl-2,3-dihydroinden-1-ylidene)hydroxylamine?
The InChIKey is AEZADCLKGKUAPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-2-8-4-3-5-10-9(8)6-7-11(10)12-13/h2-5,13H,1,6-7H2.
What are the key properties of N-(4-ethenyl-2,3-dihydroinden-1-ylidene)hydroxylamine?
N-(4-ethenyl-2,3-dihydroinden-1-ylidene)hydroxylamine has a molecular weight of 173.22 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethenyl-2,3-dihydroinden-1-ylidene)hydroxylamine is sourced from PubChem (CID 86657345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).