C14H10N4O3S — CID 86657497
3'-nitrospiro[4H-pyrido[3,2-b][1,4]oxazine-2,6'-5,7-dihydrocyclopenta[b]pyridine]-3-thione (PubChem CID 86657497) has the molecular formula C14H10N4O3S and a molecular weight of 314.33 g/mol. Its IUPAC name is 3'-nitrospiro[4H-pyrido[3,2-b][1,4]oxazine-2,6'-5,7-dihydrocyclopenta[b]pyridine]-3-thione.
| Compound Name | 3'-nitrospiro[4H-pyrido[3,2-b][1,4]oxazine-2,6'-5,7-dihydrocyclopenta[b]pyridine]-3-thione |
|---|---|
| PubChem CID | 86657497 |
| Molecular Formula | C14H10N4O3S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3'-nitrospiro[4H-pyrido[3,2-b][1,4]oxazine-2,6'-5,7-dihydrocyclopenta[b]pyridine]-3-thione |
| SMILES | O=[N+]([O-])c1cnc2c(c1)CC1(C2)Oc2cccnc2NC1=S |
| InChI | InChI=1S/C14H10N4O3S/c19-18(20)9-4-8-5-14(6-10(8)16-7-9)13(22)17-12-11(21-14)2-1-3-15-12/h1-4,7H,5-6H2,(H,15,17,22) |
| InChIKey | IBUFVPPKHGAHLZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|