C11H8BrF2NO2 — CID 86657563
2-bromo-1-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]ethanone (PubChem CID 86657563) has the molecular formula C11H8BrF2NO2 and a molecular weight of 304.09 g/mol. Its IUPAC name is 2-bromo-1-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]ethanone.
| Compound Name | 2-bromo-1-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]ethanone |
|---|---|
| PubChem CID | 86657563 |
| Molecular Formula | C11H8BrF2NO2 |
| Molecular Weight | 304.09 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 2-bromo-1-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]ethanone |
| SMILES | O=C(CBr)C1=NOC(c2c(F)cccc2F)C1 |
| InChI | InChI=1S/C11H8BrF2NO2/c12-5-9(16)8-4-10(17-15-8)11-6(13)2-1-3-7(11)14/h1-3,10H,4-5H2 |
| InChIKey | PGONUFQCBRMACB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.09 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|