About 3,4-diphenyl-1,4-dihydropyrazole-5-thione
3,4-diphenyl-1,4-dihydropyrazole-5-thione (PubChem CID 86657576) has the molecular formula C15H12N2S
and a molecular weight of 252.34 g/mol. Its IUPAC name is 3,4-diphenyl-1,4-dihydropyrazole-5-thione.
Molecular Properties
| Compound Name | 3,4-diphenyl-1,4-dihydropyrazole-5-thione |
| PubChem CID | 86657576 |
| Molecular Formula | C15H12N2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3,4-diphenyl-1,4-dihydropyrazole-5-thione |
| SMILES | S=C1NN=C(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C15H12N2S/c18-15-13(11-7-3-1-4-8-11)14(16-17-15)12-9-5-2-6-10-12/h1-10,13H,(H,17,18) |
| InChIKey | PKGVUDSUBPUFOP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diphenyl-1,4-dihydropyrazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diphenyl-1,4-dihydropyrazole-5-thione?
The IUPAC name of 3,4-diphenyl-1,4-dihydropyrazole-5-thione (CID 86657576) is 3,4-diphenyl-1,4-dihydropyrazole-5-thione.
What is the SMILES notation for 3,4-diphenyl-1,4-dihydropyrazole-5-thione?
The canonical SMILES for 3,4-diphenyl-1,4-dihydropyrazole-5-thione is S=C1NN=C(c2ccccc2)C1c1ccccc1.
What is the InChIKey of 3,4-diphenyl-1,4-dihydropyrazole-5-thione?
The InChIKey is PKGVUDSUBPUFOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2S/c18-15-13(11-7-3-1-4-8-11)14(16-17-15)12-9-5-2-6-10-12/h1-10,13H,(H,17,18).
What are the key properties of 3,4-diphenyl-1,4-dihydropyrazole-5-thione?
3,4-diphenyl-1,4-dihydropyrazole-5-thione has a molecular weight of 252.34 g/mol, XLogP of 3.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diphenyl-1,4-dihydropyrazole-5-thione is sourced from PubChem (CID 86657576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).