C22H22N4O2S — CID 8665771
N-(2-cyanoethyl)-2-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-methylacetamide (PubChem CID 8665771) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-methylacetamide.
| Compound Name | N-(2-cyanoethyl)-2-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 8665771 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-(2-cyanoethyl)-2-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-methylacetamide |
| SMILES | CCc1ccccc1-n1c(SCC(=O)N(C)CCC#N)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H22N4O2S/c1-3-16-9-4-7-12-19(16)26-21(28)17-10-5-6-11-18(17)24-22(26)29-15-20(27)25(2)14-8-13-23/h4-7,9-12H,3,8,14-15H2,1-2H3 |
| InChIKey | DLTGUBPFIADCOR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |