C23H27N3O2S — CID 8665776
2-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methylbutyl)acetamide (PubChem CID 8665776) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methylbutyl)acetamide.
| Compound Name | 2-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 8665776 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-[3-(2-ethylphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(3-methylbutyl)acetamide |
| SMILES | CCc1ccccc1-n1c(SCC(=O)NCCC(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H27N3O2S/c1-4-17-9-5-8-12-20(17)26-22(28)18-10-6-7-11-19(18)25-23(26)29-15-21(27)24-14-13-16(2)3/h5-12,16H,4,13-15H2,1-3H3,(H,24,27) |
| InChIKey | LBVFJKVAXYMSCY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |