C18H31BrN2O2 — CID 86657881
11-(3-methylimidazol-3-ium-1-yl)undecyl prop-2-enoate bromide (PubChem CID 86657881) has the molecular formula C18H31BrN2O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is 11-(3-methylimidazol-3-ium-1-yl)undecyl prop-2-enoate bromide.
| Compound Name | 11-(3-methylimidazol-3-ium-1-yl)undecyl prop-2-enoate bromide |
|---|---|
| PubChem CID | 86657881 |
| Molecular Formula | C18H31BrN2O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 11-(3-methylimidazol-3-ium-1-yl)undecyl prop-2-enoate bromide |
| SMILES | C=CC(=O)OCCCCCCCCCCCn1cc[n+](C)c1.[Br-] |
| InChI | InChI=1S/C18H31N2O2.BrH/c1-3-18(21)22-16-12-10-8-6-4-5-7-9-11-13-20-15-14-19(2)17-20;/h3,14-15,17H,1,4-13,16H2,2H3;1H/q+1;/p-1 |
| InChIKey | KGKVAHMKXCLTOV-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|