C9H11NO4S2 — CID 86658143
2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethyl methanesulfonate (PubChem CID 86658143) has the molecular formula C9H11NO4S2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethyl methanesulfonate.
| Compound Name | 2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethyl methanesulfonate |
|---|---|
| PubChem CID | 86658143 |
| Molecular Formula | C9H11NO4S2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 2,3-dihydro-[1,4]oxathiino[2,3-c]pyridin-7-ylmethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1cc2c(cn1)OCCS2 |
| InChI | InChI=1S/C9H11NO4S2/c1-16(11,12)14-6-7-4-9-8(5-10-7)13-2-3-15-9/h4-5H,2-3,6H2,1H3 |
| InChIKey | WXDBIYAWOFLXAX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|