About 6-(2,2-difluoro-2-phenylethoxy)-4,4-difluorohexanal
6-(2,2-difluoro-2-phenylethoxy)-4,4-difluorohexanal (PubChem CID 86658314) has the molecular formula C14H16F4O2
and a molecular weight of 292.27 g/mol. Its IUPAC name is 6-(2,2-difluoro-2-phenylethoxy)-4,4-difluorohexanal.
Molecular Properties
| Compound Name | 6-(2,2-difluoro-2-phenylethoxy)-4,4-difluorohexanal |
| PubChem CID | 86658314 |
| Molecular Formula | C14H16F4O2 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 6-(2,2-difluoro-2-phenylethoxy)-4,4-difluorohexanal |
| SMILES | O=CCCC(F)(F)CCOCC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C14H16F4O2/c15-13(16,7-4-9-19)8-10-20-11-14(17,18)12-5-2-1-3-6-12/h1-3,5-6,9H,4,7-8,10-11H2 |
| InChIKey | GJFUMKKKYQTKCT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,2-difluoro-2-phenylethoxy)-4,4-difluorohexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2-difluoro-2-phenylethoxy)-4,4-difluorohexanal?
The IUPAC name of 6-(2,2-difluoro-2-phenylethoxy)-4,4-difluorohexanal (CID 86658314) is 6-(2,2-difluoro-2-phenylethoxy)-4,4-difluorohexanal.
What is the SMILES notation for 6-(2,2-difluoro-2-phenylethoxy)-4,4-difluorohexanal?
The canonical SMILES for 6-(2,2-difluoro-2-phenylethoxy)-4,4-difluorohexanal is O=CCCC(F)(F)CCOCC(F)(F)c1ccccc1.
What is the InChIKey of 6-(2,2-difluoro-2-phenylethoxy)-4,4-difluorohexanal?
The InChIKey is GJFUMKKKYQTKCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F4O2/c15-13(16,7-4-9-19)8-10-20-11-14(17,18)12-5-2-1-3-6-12/h1-3,5-6,9H,4,7-8,10-11H2.
What are the key properties of 6-(2,2-difluoro-2-phenylethoxy)-4,4-difluorohexanal?
6-(2,2-difluoro-2-phenylethoxy)-4,4-difluorohexanal has a molecular weight of 292.27 g/mol, XLogP of 3.80, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-difluoro-2-phenylethoxy)-4,4-difluorohexanal is sourced from PubChem (CID 86658314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).