C25H28F2N8O3S — CID 86658428
tert-butyl N-[4-[[5-(4-azidocyclohexyl)-1-methylpyrazol-4-yl]carbamoyl]-2-(2,6-difluorophenyl)-1,3-thiazol-5-yl]carbamate (PubChem CID 86658428) has the molecular formula C25H28F2N8O3S and a molecular weight of 558.62 g/mol. Its IUPAC name is tert-butyl N-[4-[[5-(4-azidocyclohexyl)-1-methylpyrazol-4-yl]carbamoyl]-2-(2,6-difluorophenyl)-1,3-thiazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[5-(4-azidocyclohexyl)-1-methylpyrazol-4-yl]carbamoyl]-2-(2,6-difluorophenyl)-1,3-thiazol-5-yl]carbamate |
|---|---|
| PubChem CID | 86658428 |
| Molecular Formula | C25H28F2N8O3S |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | tert-butyl N-[4-[[5-(4-azidocyclohexyl)-1-methylpyrazol-4-yl]carbamoyl]-2-(2,6-difluorophenyl)-1,3-thiazol-5-yl]carbamate |
| SMILES | Cn1ncc(NC(=O)c2nc(-c3c(F)cccc3F)sc2NC(=O)OC(C)(C)C)c1C1CCC(N=[N+]=[N-])CC1 |
| InChI | InChI=1S/C25H28F2N8O3S/c1-25(2,3)38-24(37)32-23-19(31-22(39-23)18-15(26)6-5-7-16(18)27)21(36)30-17-12-29-35(4)20(17)13-8-10-14(11-9-13)33-34-28/h5-7,12-14H,8-11H2,1-4H3,(H,30,36)(H,32,37) |
| InChIKey | XBOOIDNHIFLUBT-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 146.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|