C21H17F3N2O6S — CID 86658491
[(4R)-2-amino-7'-(3,6-dihydro-2H-pyran-4-yl)spiro[5H-1,3-oxazole-4,9'-xanthene]-2'-yl] trifluoromethanesulfonate (PubChem CID 86658491) has the molecular formula C21H17F3N2O6S and a molecular weight of 482.44 g/mol. Its IUPAC name is [(4R)-2-amino-7'-(3,6-dihydro-2H-pyran-4-yl)spiro[5H-1,3-oxazole-4,9'-xanthene]-2'-yl] trifluoromethanesulfonate.
| Compound Name | [(4R)-2-amino-7'-(3,6-dihydro-2H-pyran-4-yl)spiro[5H-1,3-oxazole-4,9'-xanthene]-2'-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86658491 |
| Molecular Formula | C21H17F3N2O6S |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | [(4R)-2-amino-7'-(3,6-dihydro-2H-pyran-4-yl)spiro[5H-1,3-oxazole-4,9'-xanthene]-2'-yl] trifluoromethanesulfonate |
| SMILES | NC1=N[C@@]2(CO1)c1cc(OS(=O)(=O)C(F)(F)F)ccc1Oc1ccc(C3=CCOCC3)cc12 |
| InChI | InChI=1S/C21H17F3N2O6S/c22-21(23,24)33(27,28)32-14-2-4-18-16(10-14)20(11-30-19(25)26-20)15-9-13(1-3-17(15)31-18)12-5-7-29-8-6-12/h1-5,9-10H,6-8,11H2,(H2,25,26)/t20-/m1/s1 |
| InChIKey | RAKCEUKKGJBRBB-HXUWFJFHSA-N |
| XLogP | 3.41 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|