C21H20Cl2F3N3O2 — CID 86658522
4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N'-methoxy-N,N,2-trimethylbenzenecarboximidamide (PubChem CID 86658522) has the molecular formula C21H20Cl2F3N3O2 and a molecular weight of 474.31 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N'-methoxy-N,N,2-trimethylbenzenecarboximidamide.
| Compound Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N'-methoxy-N,N,2-trimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 86658522 |
| Molecular Formula | C21H20Cl2F3N3O2 |
| Molecular Weight | 474.31 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N'-methoxy-N,N,2-trimethylbenzenecarboximidamide |
| SMILES | CON=C(c1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1C)N(C)C |
| InChI | InChI=1S/C21H20Cl2F3N3O2/c1-12-7-13(5-6-17(12)19(28-30-4)29(2)3)18-11-20(31-27-18,21(24,25)26)14-8-15(22)10-16(23)9-14/h5-10H,11H2,1-4H3 |
| InChIKey | GSFKLJONWRGOME-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.31 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|