About ethene;methyl prop-2-enoate;prop-1-ene
ethene;methyl prop-2-enoate;prop-1-ene (PubChem CID 86658588) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is ethene;methyl prop-2-enoate;prop-1-ene.
Molecular Properties
| Compound Name | ethene;methyl prop-2-enoate;prop-1-ene |
| PubChem CID | 86658588 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | ethene;methyl prop-2-enoate;prop-1-ene |
| SMILES | C=C.C=CC.C=CC(=O)OC |
| InChI | InChI=1S/C4H6O2.C3H6.C2H4/c1-3-4(5)6-2;1-3-2;1-2/h3H,1H2,2H3;3H,1H2,2H3;1-2H2 |
| InChIKey | NMDOGYDLOCYILO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethene;methyl prop-2-enoate;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;methyl prop-2-enoate;prop-1-ene?
The IUPAC name of ethene;methyl prop-2-enoate;prop-1-ene (CID 86658588) is ethene;methyl prop-2-enoate;prop-1-ene.
What is the SMILES notation for ethene;methyl prop-2-enoate;prop-1-ene?
The canonical SMILES for ethene;methyl prop-2-enoate;prop-1-ene is C=C.C=CC.C=CC(=O)OC.
What is the InChIKey of ethene;methyl prop-2-enoate;prop-1-ene?
The InChIKey is NMDOGYDLOCYILO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C3H6.C2H4/c1-3-4(5)6-2;1-3-2;1-2/h3H,1H2,2H3;3H,1H2,2H3;1-2H2.
What are the key properties of ethene;methyl prop-2-enoate;prop-1-ene?
ethene;methyl prop-2-enoate;prop-1-ene has a molecular weight of 156.22 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;methyl prop-2-enoate;prop-1-ene is sourced from PubChem (CID 86658588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).