C23H17FN4O3S — CID 86658597
1-cyclopropyl-3-[3-fluoro-4-[2-(6-formyl-3-pyridinyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]urea (PubChem CID 86658597) has the molecular formula C23H17FN4O3S and a molecular weight of 448.48 g/mol. Its IUPAC name is 1-cyclopropyl-3-[3-fluoro-4-[2-(6-formyl-3-pyridinyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]urea.
| Compound Name | 1-cyclopropyl-3-[3-fluoro-4-[2-(6-formyl-3-pyridinyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 86658597 |
| Molecular Formula | C23H17FN4O3S |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 1-cyclopropyl-3-[3-fluoro-4-[2-(6-formyl-3-pyridinyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]urea |
| SMILES | O=Cc1ccc(-c2cc3nccc(Oc4ccc(NC(=O)NC5CC5)cc4F)c3s2)cn1 |
| InChI | InChI=1S/C23H17FN4O3S/c24-17-9-15(28-23(30)27-14-3-4-14)5-6-19(17)31-20-7-8-25-18-10-21(32-22(18)20)13-1-2-16(12-29)26-11-13/h1-2,5-12,14H,3-4H2,(H2,27,28,30) |
| InChIKey | YHIFHJQJYSIODB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|