C10H6Cl2F3NO3 — CID 86658673
2,6-dichloro-3-[[(2,2,2-trifluoroacetyl)amino]methyl]benzoic acid (PubChem CID 86658673) has the molecular formula C10H6Cl2F3NO3 and a molecular weight of 316.06 g/mol. Its IUPAC name is 2,6-dichloro-3-[[(2,2,2-trifluoroacetyl)amino]methyl]benzoic acid.
| Compound Name | 2,6-dichloro-3-[[(2,2,2-trifluoroacetyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 86658673 |
| Molecular Formula | C10H6Cl2F3NO3 |
| Molecular Weight | 316.06 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | 2,6-dichloro-3-[[(2,2,2-trifluoroacetyl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1c(Cl)ccc(CNC(=O)C(F)(F)F)c1Cl |
| InChI | InChI=1S/C10H6Cl2F3NO3/c11-5-2-1-4(7(12)6(5)8(17)18)3-16-9(19)10(13,14)15/h1-2H,3H2,(H,16,19)(H,17,18) |
| InChIKey | JCMMUUHWTLIEFT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.06 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |