C15H19ClN5O2S- — CID 86658843
5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine;hexanoate (PubChem CID 86658843) has the molecular formula C15H19ClN5O2S- and a molecular weight of 368.87 g/mol. Its IUPAC name is 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine;hexanoate.
| Compound Name | 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine;hexanoate |
|---|---|
| PubChem CID | 86658843 |
| Molecular Formula | C15H19ClN5O2S- |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine;hexanoate |
| SMILES | CCCCCC(=O)[O-].Clc1ccc2nsnc2c1NC1=NCCN1 |
| InChI | InChI=1S/C9H8ClN5S.C6H12O2/c10-5-1-2-6-8(15-16-14-6)7(5)13-9-11-3-4-12-9;1-2-3-4-5-6(7)8/h1-2H,3-4H2,(H2,11,12,13);2-5H2,1H3,(H,7,8)/p-1 |
| InChIKey | PYPLURBHYMKYQD-UHFFFAOYSA-M |
| XLogP | 2.03 |
| TPSA | 102.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|