C21H21FN2O5 — CID 8665910
[2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] (E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoate (PubChem CID 8665910) has the molecular formula C21H21FN2O5 and a molecular weight of 400.41 g/mol. Its IUPAC name is [2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] (E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoate.
| Compound Name | [2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] (E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 8665910 |
| Molecular Formula | C21H21FN2O5 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | [2-[(3R)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] (E)-3-[5-(2-fluorophenyl)furan-2-yl]prop-2-enoate |
| SMILES | NC(=O)[C@@H]1CCCN(C(=O)COC(=O)/C=C/c2ccc(-c3ccccc3F)o2)C1 |
| InChI | InChI=1S/C21H21FN2O5/c22-17-6-2-1-5-16(17)18-9-7-15(29-18)8-10-20(26)28-13-19(25)24-11-3-4-14(12-24)21(23)27/h1-2,5-10,14H,3-4,11-13H2,(H2,23,27)/b10-8+/t14-/m1/s1 |
| InChIKey | RAHANEZMKPPWNC-QSYFUGGGSA-N |
| XLogP | 2.37 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|