About 2-chloro-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one
2-chloro-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one (PubChem CID 86659277) has the molecular formula C7H6ClN3O2
and a molecular weight of 199.60 g/mol. Its IUPAC name is 2-chloro-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one.
Molecular Properties
| Compound Name | 2-chloro-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one |
| PubChem CID | 86659277 |
| Molecular Formula | C7H6ClN3O2 |
| Molecular Weight | 199.60 g/mol |
| Exact Mass | 199.01 |
| IUPAC Name | 2-chloro-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one |
| SMILES | Cc1nc(Cl)nc2c1OCC(=O)N2 |
| InChI | InChI=1S/C7H6ClN3O2/c1-3-5-6(11-7(8)9-3)10-4(12)2-13-5/h2H2,1H3,(H,9,10,11,12) |
| InChIKey | LCISHCJNEGTYHA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.60 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one?
The IUPAC name of 2-chloro-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one (CID 86659277) is 2-chloro-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one.
What is the SMILES notation for 2-chloro-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one?
The canonical SMILES for 2-chloro-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one is Cc1nc(Cl)nc2c1OCC(=O)N2.
What is the InChIKey of 2-chloro-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one?
The InChIKey is LCISHCJNEGTYHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3O2/c1-3-5-6(11-7(8)9-3)10-4(12)2-13-5/h2H2,1H3,(H,9,10,11,12).
What are the key properties of 2-chloro-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one?
2-chloro-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one has a molecular weight of 199.60 g/mol, XLogP of 0.77, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methyl-8H-pyrimido[5,4-b][1,4]oxazin-7-one is sourced from PubChem (CID 86659277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).