C22H29ClN4O3Si — CID 86659458
2-[[(3R)-3-amino-2,3-dihydro-1H-inden-5-yl]oxy]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbaldehyde;hydrochloride (PubChem CID 86659458) has the molecular formula C22H29ClN4O3Si and a molecular weight of 461.04 g/mol. Its IUPAC name is 2-[[(3R)-3-amino-2,3-dihydro-1H-inden-5-yl]oxy]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbaldehyde;hydrochloride.
| Compound Name | 2-[[(3R)-3-amino-2,3-dihydro-1H-inden-5-yl]oxy]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbaldehyde;hydrochloride |
|---|---|
| PubChem CID | 86659458 |
| Molecular Formula | C22H29ClN4O3Si |
| Molecular Weight | 461.04 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-[[(3R)-3-amino-2,3-dihydro-1H-inden-5-yl]oxy]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbaldehyde;hydrochloride |
| SMILES | C[Si](C)(C)CCOCn1cc(C=O)c2nc(Oc3ccc4c(c3)[C@H](N)CC4)cnc21.Cl |
| InChI | InChI=1S/C22H28N4O3Si.ClH/c1-30(2,3)9-8-28-14-26-12-16(13-27)21-22(26)24-11-20(25-21)29-17-6-4-15-5-7-19(23)18(15)10-17;/h4,6,10-13,19H,5,7-9,14,23H2,1-3H3;1H/t19-;/m1./s1 |
| InChIKey | SOJSKNVBMGKKPY-FSRHSHDFSA-N |
| XLogP | 4.72 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.04 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|