C27H30N6O2 — CID 86659801
tert-butyl 4-[4-[1-[(Z)-benzylideneamino]pyrrolo[3,2-b]pyridin-6-yl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 86659801) has the molecular formula C27H30N6O2 and a molecular weight of 470.58 g/mol. Its IUPAC name is tert-butyl 4-[4-[1-[(Z)-benzylideneamino]pyrrolo[3,2-b]pyridin-6-yl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[1-[(Z)-benzylideneamino]pyrrolo[3,2-b]pyridin-6-yl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86659801 |
| Molecular Formula | C27H30N6O2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | tert-butyl 4-[4-[1-[(Z)-benzylideneamino]pyrrolo[3,2-b]pyridin-6-yl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(-c3cnc4ccn(/N=C\c5ccccc5)c4c3)cn2)CC1 |
| InChI | InChI=1S/C27H30N6O2/c1-27(2,3)35-26(34)31-12-9-23(10-13-31)33-19-22(18-30-33)21-15-25-24(28-17-21)11-14-32(25)29-16-20-7-5-4-6-8-20/h4-8,11,14-19,23H,9-10,12-13H2,1-3H3/b29-16- |
| InChIKey | NIVUQGXAYPQIJZ-MWLSYYOVSA-N |
| XLogP | 5.35 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|