C24H23Cl2F3N2O3 — CID 86659831
N-[5-[C-[(Z)-2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-enyl]-N-hydroxycarbonimidoyl]-2,3-dihydro-1H-inden-1-yl]-3-methoxybutanamide (PubChem CID 86659831) has the molecular formula C24H23Cl2F3N2O3 and a molecular weight of 515.36 g/mol. Its IUPAC name is N-[5-[C-[(Z)-2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-enyl]-N-hydroxycarbonimidoyl]-2,3-dihydro-1H-inden-1-yl]-3-methoxybutanamide.
| Compound Name | N-[5-[C-[(Z)-2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-enyl]-N-hydroxycarbonimidoyl]-2,3-dihydro-1H-inden-1-yl]-3-methoxybutanamide |
|---|---|
| PubChem CID | 86659831 |
| Molecular Formula | C24H23Cl2F3N2O3 |
| Molecular Weight | 515.36 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | N-[5-[C-[(Z)-2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-enyl]-N-hydroxycarbonimidoyl]-2,3-dihydro-1H-inden-1-yl]-3-methoxybutanamide |
| SMILES | COC(C)CC(=O)NC1CCc2cc(C(/C=C(/c3cc(Cl)cc(Cl)c3)C(F)(F)F)=NO)ccc21 |
| InChI | InChI=1S/C24H23Cl2F3N2O3/c1-13(34-2)7-23(32)30-21-6-4-14-8-15(3-5-19(14)21)22(31-33)12-20(24(27,28)29)16-9-17(25)11-18(26)10-16/h3,5,8-13,21,33H,4,6-7H2,1-2H3,(H,30,32)/b20-12-,31-22? |
| InChIKey | FJIGEEUWFZJQQX-PIAXVJPVSA-N |
| XLogP | 6.35 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.36 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|