C20H30N4O2 — CID 86660876
N-[4-[2-[4-(2,3-dihydrofuro[2,3-c]pyridin-7-yl)piperazin-1-yl]ethyl]cyclohexyl]formamide (PubChem CID 86660876) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-[4-[2-[4-(2,3-dihydrofuro[2,3-c]pyridin-7-yl)piperazin-1-yl]ethyl]cyclohexyl]formamide.
| Compound Name | N-[4-[2-[4-(2,3-dihydrofuro[2,3-c]pyridin-7-yl)piperazin-1-yl]ethyl]cyclohexyl]formamide |
|---|---|
| PubChem CID | 86660876 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N-[4-[2-[4-(2,3-dihydrofuro[2,3-c]pyridin-7-yl)piperazin-1-yl]ethyl]cyclohexyl]formamide |
| SMILES | O=CNC1CCC(CCN2CCN(c3nccc4c3OCC4)CC2)CC1 |
| InChI | InChI=1S/C20H30N4O2/c25-15-22-18-3-1-16(2-4-18)6-9-23-10-12-24(13-11-23)20-19-17(5-8-21-20)7-14-26-19/h5,8,15-16,18H,1-4,6-7,9-14H2,(H,22,25) |
| InChIKey | VCJWHCHPZKOTIP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|