C13H9F3N4O4S — CID 86661684
[7-(6-methoxy-3-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate (PubChem CID 86661684) has the molecular formula C13H9F3N4O4S and a molecular weight of 374.30 g/mol. Its IUPAC name is [7-(6-methoxy-3-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate.
| Compound Name | [7-(6-methoxy-3-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86661684 |
| Molecular Formula | C13H9F3N4O4S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | [7-(6-methoxy-3-pyridinyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(-c2ccc3cnc(OS(=O)(=O)C(F)(F)F)nn23)cn1 |
| InChI | InChI=1S/C13H9F3N4O4S/c1-23-11-5-2-8(6-17-11)10-4-3-9-7-18-12(19-20(9)10)24-25(21,22)13(14,15)16/h2-7H,1H3 |
| InChIKey | HXYYJHSMIOWORY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 95.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|