C29H48N2O4 — CID 86661768
tert-butyl N-[2,2-dimethyl-5-[(6-octyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1,3-dioxan-5-yl]carbamate (PubChem CID 86661768) has the molecular formula C29H48N2O4 and a molecular weight of 488.71 g/mol. Its IUPAC name is tert-butyl N-[2,2-dimethyl-5-[(6-octyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1,3-dioxan-5-yl]carbamate.
| Compound Name | tert-butyl N-[2,2-dimethyl-5-[(6-octyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1,3-dioxan-5-yl]carbamate |
|---|---|
| PubChem CID | 86661768 |
| Molecular Formula | C29H48N2O4 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.36 |
| IUPAC Name | tert-butyl N-[2,2-dimethyl-5-[(6-octyl-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-1,3-dioxan-5-yl]carbamate |
| SMILES | CCCCCCCCc1ccc2c(c1)CCN(CC1(NC(=O)OC(C)(C)C)COC(C)(C)OC1)C2 |
| InChI | InChI=1S/C29H48N2O4/c1-7-8-9-10-11-12-13-23-14-15-25-19-31(17-16-24(25)18-23)20-29(21-33-28(5,6)34-22-29)30-26(32)35-27(2,3)4/h14-15,18H,7-13,16-17,19-22H2,1-6H3,(H,30,32) |
| InChIKey | AEZFUYAFQYVBSM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|