About 5-bromo-3-(5-methyl-1,2,4-oxadiazol-3-yl)pyrazin-2-amine
5-bromo-3-(5-methyl-1,2,4-oxadiazol-3-yl)pyrazin-2-amine (PubChem CID 86662079) has the molecular formula C7H6BrN5O
and a molecular weight of 256.06 g/mol. Its IUPAC name is 5-bromo-3-(5-methyl-1,2,4-oxadiazol-3-yl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-3-(5-methyl-1,2,4-oxadiazol-3-yl)pyrazin-2-amine |
| PubChem CID | 86662079 |
| Molecular Formula | C7H6BrN5O |
| Molecular Weight | 256.06 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | 5-bromo-3-(5-methyl-1,2,4-oxadiazol-3-yl)pyrazin-2-amine |
| SMILES | Cc1nc(-c2nc(Br)cnc2N)no1 |
| InChI | InChI=1S/C7H6BrN5O/c1-3-11-7(13-14-3)5-6(9)10-2-4(8)12-5/h2H,1H3,(H2,9,10) |
| InChIKey | DKOJKCXNHOFRTB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.06 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-3-(5-methyl-1,2,4-oxadiazol-3-yl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(5-methyl-1,2,4-oxadiazol-3-yl)pyrazin-2-amine?
The IUPAC name of 5-bromo-3-(5-methyl-1,2,4-oxadiazol-3-yl)pyrazin-2-amine (CID 86662079) is 5-bromo-3-(5-methyl-1,2,4-oxadiazol-3-yl)pyrazin-2-amine.
What is the SMILES notation for 5-bromo-3-(5-methyl-1,2,4-oxadiazol-3-yl)pyrazin-2-amine?
The canonical SMILES for 5-bromo-3-(5-methyl-1,2,4-oxadiazol-3-yl)pyrazin-2-amine is Cc1nc(-c2nc(Br)cnc2N)no1.
What is the InChIKey of 5-bromo-3-(5-methyl-1,2,4-oxadiazol-3-yl)pyrazin-2-amine?
The InChIKey is DKOJKCXNHOFRTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN5O/c1-3-11-7(13-14-3)5-6(9)10-2-4(8)12-5/h2H,1H3,(H2,9,10).
What are the key properties of 5-bromo-3-(5-methyl-1,2,4-oxadiazol-3-yl)pyrazin-2-amine?
5-bromo-3-(5-methyl-1,2,4-oxadiazol-3-yl)pyrazin-2-amine has a molecular weight of 256.06 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(5-methyl-1,2,4-oxadiazol-3-yl)pyrazin-2-amine is sourced from PubChem (CID 86662079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).