C28H31F5O6S2 — CID 86662326
2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;4-(thiolan-1-ium-1-yl)naphthalen-1-ol (PubChem CID 86662326) has the molecular formula C28H31F5O6S2 and a molecular weight of 622.67 g/mol. Its IUPAC name is 2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;4-(thiolan-1-ium-1-yl)naphthalen-1-ol.
| Compound Name | 2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;4-(thiolan-1-ium-1-yl)naphthalen-1-ol |
|---|---|
| PubChem CID | 86662326 |
| Molecular Formula | C28H31F5O6S2 |
| Molecular Weight | 622.67 g/mol |
| Exact Mass | 622.15 |
| IUPAC Name | 2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropane-1-sulfonate;4-(thiolan-1-ium-1-yl)naphthalen-1-ol |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])C12CC3CC(CC(C3)C1)C2.Oc1ccc([S+]2CCCC2)c2ccccc12 |
| InChI | InChI=1S/C14H17F5O5S.C14H14OS/c15-13(16,17)10(14(18,19)25(21,22)23)24-11(20)12-4-7-1-8(5-12)3-9(2-7)6-12;15-13-7-8-14(16-9-3-4-10-16)12-6-2-1-5-11(12)13/h7-10H,1-6H2,(H,21,22,23);1-2,5-8H,3-4,9-10H2 |
| InChIKey | AXGBYOMCZFBWQF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.67 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|