C30H32N4O4S — CID 86662452
3-(1-aminopyridazin-1-ium-4-yl)-4-methyl-N-(1-phenylcyclopropyl)benzamide;2,4,6-trimethylbenzenesulfonate (PubChem CID 86662452) has the molecular formula C30H32N4O4S and a molecular weight of 544.68 g/mol. Its IUPAC name is 3-(1-aminopyridazin-1-ium-4-yl)-4-methyl-N-(1-phenylcyclopropyl)benzamide;2,4,6-trimethylbenzenesulfonate.
| Compound Name | 3-(1-aminopyridazin-1-ium-4-yl)-4-methyl-N-(1-phenylcyclopropyl)benzamide;2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 86662452 |
| Molecular Formula | C30H32N4O4S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 3-(1-aminopyridazin-1-ium-4-yl)-4-methyl-N-(1-phenylcyclopropyl)benzamide;2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1.Cc1ccc(C(=O)NC2(c3ccccc3)CC2)cc1-c1cc[n+](N)nc1 |
| InChI | InChI=1S/C21H20N4O.C9H12O3S/c1-15-7-8-16(13-19(15)17-9-12-25(22)23-14-17)20(26)24-21(10-11-21)18-5-3-2-4-6-18;1-6-4-7(2)9(8(3)5-6)13(10,11)12/h2-9,12-14H,10-11H2,1H3,(H2-,22,23,24,26);4-5H,1-3H3,(H,10,11,12) |
| InChIKey | CHHCFZUQZHEEFR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 129.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|