C12H11ClO3 — CID 86662457
4-(4-chloro-2-methylphenyl)oxane-2,6-dione (PubChem CID 86662457) has the molecular formula C12H11ClO3 and a molecular weight of 238.67 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenyl)oxane-2,6-dione.
| Compound Name | 4-(4-chloro-2-methylphenyl)oxane-2,6-dione |
|---|---|
| PubChem CID | 86662457 |
| Molecular Formula | C12H11ClO3 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 4-(4-chloro-2-methylphenyl)oxane-2,6-dione |
| SMILES | Cc1cc(Cl)ccc1C1CC(=O)OC(=O)C1 |
| InChI | InChI=1S/C12H11ClO3/c1-7-4-9(13)2-3-10(7)8-5-11(14)16-12(15)6-8/h2-4,8H,5-6H2,1H3 |
| InChIKey | UNRUZWXLGSQXBN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|