C29H28O4 — CID 86662462
ethyl (E)-5-[6-(methoxymethoxy)naphthalen-2-yl]-3-naphthalen-2-ylpent-2-enoate (PubChem CID 86662462) has the molecular formula C29H28O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is ethyl (E)-5-[6-(methoxymethoxy)naphthalen-2-yl]-3-naphthalen-2-ylpent-2-enoate.
| Compound Name | ethyl (E)-5-[6-(methoxymethoxy)naphthalen-2-yl]-3-naphthalen-2-ylpent-2-enoate |
|---|---|
| PubChem CID | 86662462 |
| Molecular Formula | C29H28O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | ethyl (E)-5-[6-(methoxymethoxy)naphthalen-2-yl]-3-naphthalen-2-ylpent-2-enoate |
| SMILES | CCOC(=O)/C=C(\CCc1ccc2cc(OCOC)ccc2c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H28O4/c1-3-32-29(30)19-27(25-13-12-22-6-4-5-7-23(22)17-25)11-9-21-8-10-26-18-28(33-20-31-2)15-14-24(26)16-21/h4-8,10,12-19H,3,9,11,20H2,1-2H3/b27-19+ |
| InChIKey | FEIBSOJLOOWXPN-ZXVVBBHZSA-N |
| XLogP | 6.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|