About sodium;2-methylpropan-2-olate;oxolane
sodium;2-methylpropan-2-olate;oxolane (PubChem CID 86662483) has the molecular formula C8H17NaO2
and a molecular weight of 168.21 g/mol. Its IUPAC name is sodium;2-methylpropan-2-olate;oxolane.
Molecular Properties
| Compound Name | sodium;2-methylpropan-2-olate;oxolane |
| PubChem CID | 86662483 |
| Molecular Formula | C8H17NaO2 |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | sodium;2-methylpropan-2-olate;oxolane |
| SMILES | C1CCOC1.CC(C)(C)[O-].[Na+] |
| InChI | InChI=1S/C4H8O.C4H9O.Na/c1-2-4-5-3-1;1-4(2,3)5;/h1-4H2;1-3H3;/q;-1;+1 |
| InChIKey | DNEGUUKFMQTAGX-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;2-methylpropan-2-olate;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-methylpropan-2-olate;oxolane?
The IUPAC name of sodium;2-methylpropan-2-olate;oxolane (CID 86662483) is sodium;2-methylpropan-2-olate;oxolane.
What is the SMILES notation for sodium;2-methylpropan-2-olate;oxolane?
The canonical SMILES for sodium;2-methylpropan-2-olate;oxolane is C1CCOC1.CC(C)(C)[O-].[Na+].
What is the InChIKey of sodium;2-methylpropan-2-olate;oxolane?
The InChIKey is DNEGUUKFMQTAGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C4H9O.Na/c1-2-4-5-3-1;1-4(2,3)5;/h1-4H2;1-3H3;/q;-1;+1.
What are the key properties of sodium;2-methylpropan-2-olate;oxolane?
sodium;2-methylpropan-2-olate;oxolane has a molecular weight of 168.21 g/mol, XLogP of -2.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-methylpropan-2-olate;oxolane is sourced from PubChem (CID 86662483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).