C19H23NO4 — CID 86662492
ethyl 6-[1-(hydroxyiminomethyl)naphthalen-2-yl]oxyhexanoate (PubChem CID 86662492) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethyl 6-[1-(hydroxyiminomethyl)naphthalen-2-yl]oxyhexanoate.
| Compound Name | ethyl 6-[1-(hydroxyiminomethyl)naphthalen-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 86662492 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | ethyl 6-[1-(hydroxyiminomethyl)naphthalen-2-yl]oxyhexanoate |
| SMILES | CCOC(=O)CCCCCOc1ccc2ccccc2c1C=NO |
| InChI | InChI=1S/C19H23NO4/c1-2-23-19(21)10-4-3-7-13-24-18-12-11-15-8-5-6-9-16(15)17(18)14-20-22/h5-6,8-9,11-12,14,22H,2-4,7,10,13H2,1H3 |
| InChIKey | WBPHWUQGBYJJSC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|