About 5-tert-butyl-1,1,3-trimethyl-2H-pentalene
5-tert-butyl-1,1,3-trimethyl-2H-pentalene (PubChem CID 86662536) has the molecular formula C15H22
and a molecular weight of 202.34 g/mol. Its IUPAC name is 5-tert-butyl-1,1,3-trimethyl-2H-pentalene.
Molecular Properties
| Compound Name | 5-tert-butyl-1,1,3-trimethyl-2H-pentalene |
| PubChem CID | 86662536 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 5-tert-butyl-1,1,3-trimethyl-2H-pentalene |
| SMILES | CC1=C2C=C(C(C)(C)C)C=C2C(C)(C)C1 |
| InChI | InChI=1S/C15H22/c1-10-9-15(5,6)13-8-11(7-12(10)13)14(2,3)4/h7-8H,9H2,1-6H3 |
| InChIKey | CAWUEEJHWGDCNW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-tert-butyl-1,1,3-trimethyl-2H-pentalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-1,1,3-trimethyl-2H-pentalene?
The IUPAC name of 5-tert-butyl-1,1,3-trimethyl-2H-pentalene (CID 86662536) is 5-tert-butyl-1,1,3-trimethyl-2H-pentalene.
What is the SMILES notation for 5-tert-butyl-1,1,3-trimethyl-2H-pentalene?
The canonical SMILES for 5-tert-butyl-1,1,3-trimethyl-2H-pentalene is CC1=C2C=C(C(C)(C)C)C=C2C(C)(C)C1.
What is the InChIKey of 5-tert-butyl-1,1,3-trimethyl-2H-pentalene?
The InChIKey is CAWUEEJHWGDCNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22/c1-10-9-15(5,6)13-8-11(7-12(10)13)14(2,3)4/h7-8H,9H2,1-6H3.
What are the key properties of 5-tert-butyl-1,1,3-trimethyl-2H-pentalene?
5-tert-butyl-1,1,3-trimethyl-2H-pentalene has a molecular weight of 202.34 g/mol, XLogP of 4.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-1,1,3-trimethyl-2H-pentalene is sourced from PubChem (CID 86662536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).