About sodium;ethyl 1-(methylsulfanylmethyl)cyclopropane-1-carboxylate;methanethiolate
sodium;ethyl 1-(methylsulfanylmethyl)cyclopropane-1-carboxylate;methanethiolate (PubChem CID 86662608) has the molecular formula C9H17NaO2S2
and a molecular weight of 244.36 g/mol. Its IUPAC name is sodium;ethyl 1-(methylsulfanylmethyl)cyclopropane-1-carboxylate;methanethiolate.
Molecular Properties
| Compound Name | sodium;ethyl 1-(methylsulfanylmethyl)cyclopropane-1-carboxylate;methanethiolate |
| PubChem CID | 86662608 |
| Molecular Formula | C9H17NaO2S2 |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | sodium;ethyl 1-(methylsulfanylmethyl)cyclopropane-1-carboxylate;methanethiolate |
| SMILES | CCOC(=O)C1(CSC)CC1.C[S-].[Na+] |
| InChI | InChI=1S/C8H14O2S.CH4S.Na/c1-3-10-7(9)8(4-5-8)6-11-2;1-2;/h3-6H2,1-2H3;2H,1H3;/q;;+1/p-1 |
| InChIKey | FHMMYJGMOPDKNQ-UHFFFAOYSA-M |
| XLogP | -1.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;ethyl 1-(methylsulfanylmethyl)cyclopropane-1-carboxylate;methanethiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethyl 1-(methylsulfanylmethyl)cyclopropane-1-carboxylate;methanethiolate?
The IUPAC name of sodium;ethyl 1-(methylsulfanylmethyl)cyclopropane-1-carboxylate;methanethiolate (CID 86662608) is sodium;ethyl 1-(methylsulfanylmethyl)cyclopropane-1-carboxylate;methanethiolate.
What is the SMILES notation for sodium;ethyl 1-(methylsulfanylmethyl)cyclopropane-1-carboxylate;methanethiolate?
The canonical SMILES for sodium;ethyl 1-(methylsulfanylmethyl)cyclopropane-1-carboxylate;methanethiolate is CCOC(=O)C1(CSC)CC1.C[S-].[Na+].
What is the InChIKey of sodium;ethyl 1-(methylsulfanylmethyl)cyclopropane-1-carboxylate;methanethiolate?
The InChIKey is FHMMYJGMOPDKNQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H14O2S.CH4S.Na/c1-3-10-7(9)8(4-5-8)6-11-2;1-2;/h3-6H2,1-2H3;2H,1H3;/q;;+1/p-1.
What are the key properties of sodium;ethyl 1-(methylsulfanylmethyl)cyclopropane-1-carboxylate;methanethiolate?
sodium;ethyl 1-(methylsulfanylmethyl)cyclopropane-1-carboxylate;methanethiolate has a molecular weight of 244.36 g/mol, XLogP of -1.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethyl 1-(methylsulfanylmethyl)cyclopropane-1-carboxylate;methanethiolate is sourced from PubChem (CID 86662608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).