C17H18N6O2S — CID 86662799
2-[(4-hydroxycyclohexyl)amino]-6-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)pyrimidine-4-carbaldehyde (PubChem CID 86662799) has the molecular formula C17H18N6O2S and a molecular weight of 370.44 g/mol. Its IUPAC name is 2-[(4-hydroxycyclohexyl)amino]-6-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)pyrimidine-4-carbaldehyde.
| Compound Name | 2-[(4-hydroxycyclohexyl)amino]-6-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)pyrimidine-4-carbaldehyde |
|---|---|
| PubChem CID | 86662799 |
| Molecular Formula | C17H18N6O2S |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-[(4-hydroxycyclohexyl)amino]-6-([1,3]thiazolo[5,4-b]pyridin-2-ylamino)pyrimidine-4-carbaldehyde |
| SMILES | O=Cc1cc(Nc2nc3cccnc3s2)nc(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C17H18N6O2S/c24-9-11-8-14(23-17-21-13-2-1-7-18-15(13)26-17)22-16(20-11)19-10-3-5-12(25)6-4-10/h1-2,7-10,12,25H,3-6H2,(H2,19,20,21,22,23) |
| InChIKey | ZCCNCHUQISXPSW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|