C17H28N2O4 — CID 86662907
tert-butyl (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-ynylpyrrolidine-1-carboxylate (PubChem CID 86662907) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-ynylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-ynylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86662907 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | tert-butyl (2S,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-ynylpyrrolidine-1-carboxylate |
| SMILES | C#CC[C@H]1C[C@H](NC(=O)OC(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28N2O4/c1-8-9-13-10-12(18-14(20)22-16(2,3)4)11-19(13)15(21)23-17(5,6)7/h1,12-13H,9-11H2,2-7H3,(H,18,20)/t12-,13-/m0/s1 |
| InChIKey | DXAUDDYOKIDCIH-STQMWFEESA-N |
| XLogP | 2.91 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|