C24H29N3OS — CID 86662963
2-[4,10-dimethyl-12-(4-methylphenyl)-7-thia-9-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-11-yl]-N'-hydroxypentanimidamide (PubChem CID 86662963) has the molecular formula C24H29N3OS and a molecular weight of 407.58 g/mol. Its IUPAC name is 2-[4,10-dimethyl-12-(4-methylphenyl)-7-thia-9-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-11-yl]-N'-hydroxypentanimidamide.
| Compound Name | 2-[4,10-dimethyl-12-(4-methylphenyl)-7-thia-9-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-11-yl]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 86662963 |
| Molecular Formula | C24H29N3OS |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 2-[4,10-dimethyl-12-(4-methylphenyl)-7-thia-9-azatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-11-yl]-N'-hydroxypentanimidamide |
| SMILES | CCCC(C(N)=NO)c1c(C)nc2sc3c(c2c1-c1ccc(C)cc1)CC(C)C3 |
| InChI | InChI=1S/C24H29N3OS/c1-5-6-17(23(25)27-28)20-15(4)26-24-22(18-11-14(3)12-19(18)29-24)21(20)16-9-7-13(2)8-10-16/h7-10,14,17,28H,5-6,11-12H2,1-4H3,(H2,25,27) |
| InChIKey | WCFSCKMXDSJNGQ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|