About tert-butyl N-(6-chloroimidazo[1,2-b]pyridazin-8-yl)-N-(oxan-4-ylmethyl)carbamate
tert-butyl N-(6-chloroimidazo[1,2-b]pyridazin-8-yl)-N-(oxan-4-ylmethyl)carbamate (PubChem CID 86662992) has the molecular formula C17H23ClN4O3
and a molecular weight of 366.85 g/mol. Its IUPAC name is tert-butyl N-(6-chloroimidazo[1,2-b]pyridazin-8-yl)-N-(oxan-4-ylmethyl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(6-chloroimidazo[1,2-b]pyridazin-8-yl)-N-(oxan-4-ylmethyl)carbamate |
| PubChem CID | 86662992 |
| Molecular Formula | C17H23ClN4O3 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | tert-butyl N-(6-chloroimidazo[1,2-b]pyridazin-8-yl)-N-(oxan-4-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC1CCOCC1)c1cc(Cl)nn2ccnc12 |
| InChI | InChI=1S/C17H23ClN4O3/c1-17(2,3)25-16(23)21(11-12-4-8-24-9-5-12)13-10-14(18)20-22-7-6-19-15(13)22/h6-7,10,12H,4-5,8-9,11H2,1-3H3 |
| InChIKey | LXLIKUITCJZXSC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-(6-chloroimidazo[1,2-b]pyridazin-8-yl)-N-(oxan-4-ylmethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(6-chloroimidazo[1,2-b]pyridazin-8-yl)-N-(oxan-4-ylmethyl)carbamate?
The IUPAC name of tert-butyl N-(6-chloroimidazo[1,2-b]pyridazin-8-yl)-N-(oxan-4-ylmethyl)carbamate (CID 86662992) is tert-butyl N-(6-chloroimidazo[1,2-b]pyridazin-8-yl)-N-(oxan-4-ylmethyl)carbamate.
What is the SMILES notation for tert-butyl N-(6-chloroimidazo[1,2-b]pyridazin-8-yl)-N-(oxan-4-ylmethyl)carbamate?
The canonical SMILES for tert-butyl N-(6-chloroimidazo[1,2-b]pyridazin-8-yl)-N-(oxan-4-ylmethyl)carbamate is CC(C)(C)OC(=O)N(CC1CCOCC1)c1cc(Cl)nn2ccnc12.
What is the InChIKey of tert-butyl N-(6-chloroimidazo[1,2-b]pyridazin-8-yl)-N-(oxan-4-ylmethyl)carbamate?
The InChIKey is LXLIKUITCJZXSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23ClN4O3/c1-17(2,3)25-16(23)21(11-12-4-8-24-9-5-12)13-10-14(18)20-22-7-6-19-15(13)22/h6-7,10,12H,4-5,8-9,11H2,1-3H3.
What are the key properties of tert-butyl N-(6-chloroimidazo[1,2-b]pyridazin-8-yl)-N-(oxan-4-ylmethyl)carbamate?
tert-butyl N-(6-chloroimidazo[1,2-b]pyridazin-8-yl)-N-(oxan-4-ylmethyl)carbamate has a molecular weight of 366.85 g/mol, XLogP of 3.55, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(6-chloroimidazo[1,2-b]pyridazin-8-yl)-N-(oxan-4-ylmethyl)carbamate is sourced from PubChem (CID 86662992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).